2-(trans-4-(4-(4-Amino-5-oxo-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-6(5H)-yl)phenyl)cyclohexyl)acetic acid, 99%
cas: 1109276-89-2 — see every product listed under this CAS number, including other names
2-(trans-4-(4-(4-Amino-5-oxo-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-6(5H)-yl)phenyl)cyclohexyl)acetic acid, 99% (CAS 1109276-89-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch119TIY-5mg |
| cas | 1109276-89-2 |
| size | 5mg |
| availability | 0.2g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 304.40 Pln | |
| Chemat | 10mg | 395.60 Pln | |
| Chemat | 25mg | 726.80 Pln | |
| Chemat | 50mg | 1187.60 Pln | |
| Chemat | 100mg | 1974.80 Pln | |
| BLDpharm | 10mg | 564.27 Pln | |
| BLDpharm | 25mg | 1208.49 Pln | |
| BLDpharm | 50mg | 1719.42 Pln | |
| BLDpharm | 100mg | 3041.18 Pln | |
| BLDpharm | 250mg | 6278.92 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-[4-[4-(4-amino-5-oxo-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-6-yl)phenyl]cyclohexyl]acetic acid (CAS 1109276-89-2) is a chemical compound with the molecular formula C21H24N4O4 and a molecular weight of 396.4 g/mol. IUPAC name: 2-[4-[4-(4-amino-5-oxo-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-6-yl)phenyl]cyclohexyl]acetic acid. InChIKey: GEVVQZHMFVFGLN-UHFFFAOYSA-N.
| Molecular formula | C21H24N4O4 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 2-[4-[4-(4-amino-5-oxo-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-6-yl)phenyl]cyclohexyl]acetic acid |
| InChIKey | GEVVQZHMFVFGLN-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CC(=O)O)C2=CC=C(C=C2)N3CCOC4=NC=NC(=C4C3=O)N |
Computed by PubChem (NCBI)