CAS 130752-32-8 appears in our catalog under these names: Fmoc–D–Arg–OH · HCl, Fmoc-D-Arg-OH, >95.0%(HPLC)(T), Fmoc-D-Arg-OH 95%, Fmoc-D-Arginine, 95%, 95%, Fmoc-D-Arg-OH, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 500g, 250mg, 10g, 100g.
(2R)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 130752-32-8) is a chemical compound with the molecular formula C21H24N4O4 and a molecular weight of 396.4 g/mol. IUPAC name: (2R)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: DVBUCBXGDWWXNY-GOSISDBHSA-N.
| Molecular formula | C21H24N4O4 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (2R)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | DVBUCBXGDWWXNY-GOSISDBHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)