cas: 1251006-00-4 — see every product listed under this CAS number, including other names
2-[(tert-Butoxy)carbonyl]-5-oxa-2-azaspiro[3.4]octane-6-carboxylic acid, 95% (CAS 1251006-00-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609103-100MG |
| cas | 1251006-00-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2981.26 Pln | |
| Fluorochem | 250mg | 4220.41 Pln | |
| Fluorochem | 1g | 8349.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxa-2-azaspiro[3.4]octane-6-carboxylic acid (CAS 1251006-00-4) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxa-2-azaspiro[3.4]octane-6-carboxylic acid. InChIKey: ZNSDOJYTRJPKOY-UHFFFAOYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxa-2-azaspiro[3.4]octane-6-carboxylic acid |
| InChIKey | ZNSDOJYTRJPKOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCC(O2)C(=O)O |
Computed by PubChem (NCBI)