CAS 869564-40-9 appears in our catalog under these names: 1-tert-Butyl 2-methyl 5-oxopiperidine-1,2-dicarboxylate, 95%, 1-tert-Butyl 2-methyl 5-oxopiperidine-1,2-dicarboxylate, 97%, 1-tert-Butyl 2-methyl 5-oxopiperidine-1,2-dicarboxylate, 1-tert-Butyl 2-methyl 5-oxopiperidine-1,2-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 500mg.
1-O-tert-butyl 2-O-methyl 5-oxopiperidine-1,2-dicarboxylate (CAS 869564-40-9) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 5-oxopiperidine-1,2-dicarboxylate. InChIKey: UCRLFGKYCFXSEA-UHFFFAOYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 5-oxopiperidine-1,2-dicarboxylate |
| InChIKey | UCRLFGKYCFXSEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CCC1C(=O)OC |
Computed by PubChem (NCBI)