cas: 217433-37-9 — see every product listed under this CAS number, including other names
2-[[(TETRAHYDROPYRAN-2-YL)OXY]METHYL]BENZYL ALCOHOL (CAS 217433-37-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387456-100MG |
| cas | 217433-37-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 888.25 Pln | |
| Fluorochem | 250mg | 1034.03 Pln | |
| Fluorochem | 1g | 2434.58 Pln | |
| Fluorochem | 5g | 7661.90 Pln |
| delivery time | 3-4 weeks |
|---|
[2-(oxan-2-yloxymethyl)phenyl]methanol (CAS 217433-37-9) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: [2-(oxan-2-yloxymethyl)phenyl]methanol. InChIKey: VOCBXMPWJAQCQY-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | [2-(oxan-2-yloxymethyl)phenyl]methanol |
| InChIKey | VOCBXMPWJAQCQY-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)OCC2=CC=CC=C2CO |
Computed by PubChem (NCBI)