Products 1429901-08-5

CAS 1429901-08-5 is the registry number for Methyl 3,5-dimethyl-4-propoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3,5-dimethyl-4-propoxybenzoate (CAS 1429901-08-5) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: methyl 3,5-dimethyl-4-propoxybenzoate. InChIKey: RPYUEPHUDPMNLG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O3
Molecular weight222.28 g/mol
IUPAC namemethyl 3,5-dimethyl-4-propoxybenzoate
InChIKeyRPYUEPHUDPMNLG-UHFFFAOYSA-N
SMILESCCCOC1=C(C=C(C=C1C)C(=O)OC)C

Computed by PubChem (NCBI)