cas: 856828-07-4 — see every product listed under this CAS number, including other names
2-[2-(4-Methoxy-phenylamino)-ethyl]-isoindole-1,3-dione, 95%, 95% (CAS 856828-07-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GM5P-100mg |
| cas | 856828-07-4 |
| size | 100mg |
| availability | 12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1922.00 Pln | |
| Chemat | 500mg | 5646.80 Pln | |
| Chemat | 1g | 10893.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-(4-methoxyanilino)ethyl]isoindole-1,3-dione (CAS 856828-07-4) is a chemical compound with the molecular formula C17H16N2O3 and a molecular weight of 296.32 g/mol. IUPAC name: 2-[2-(4-methoxyanilino)ethyl]isoindole-1,3-dione. InChIKey: UGGYMBQBWONXKK-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 2-[2-(4-methoxyanilino)ethyl]isoindole-1,3-dione |
| InChIKey | UGGYMBQBWONXKK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NCCN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)