Products 1170357-94-4

CAS 1170357-94-4 is the registry number for 4-(5-[(Cyclobutylcarbonyl)amino]pyridin-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[5-(cyclobutanecarbonylamino)-2-pyridinyl]benzoic acid (CAS 1170357-94-4) is a chemical compound with the molecular formula C17H16N2O3 and a molecular weight of 296.32 g/mol. IUPAC name: 4-[5-(cyclobutanecarbonylamino)-2-pyridinyl]benzoic acid. InChIKey: ODOFDVRASRWIRK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16N2O3
Molecular weight296.32 g/mol
IUPAC name4-[5-(cyclobutanecarbonylamino)-2-pyridinyl]benzoic acid
InChIKeyODOFDVRASRWIRK-UHFFFAOYSA-N
SMILESC1CC(C1)C(=O)NC2=CN=C(C=C2)C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)