cas: 850567-57-6 — see every product listed under this CAS number, including other names
2-[2-(Bromomethyl)-4-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 850567-57-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EQ4-250mg |
| cas | 850567-57-6 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1139.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-(bromomethyl)-4-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850567-57-6) is a chemical compound with the molecular formula C13H17BBrFO2 and a molecular weight of 314.99 g/mol. IUPAC name: 2-[2-(bromomethyl)-4-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SFRDMJLPJZYEJB-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrFO2 |
|---|---|
| Molecular weight | 314.99 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-4-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SFRDMJLPJZYEJB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)CBr |
Computed by PubChem (NCBI)