cas: 111991-15-2 — see every product listed under this CAS number, including other names
2-[2-(trifluoromethyl)phenyl]oxirane, 97% (CAS 111991-15-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F665118-500MG |
| cas | 111991-15-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 883.04 Pln | |
| Fluorochem | 1g | 1247.50 Pln | |
| Fluorochem | 5g | 3600.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-(trifluoromethyl)phenyl]oxirane (CAS 111991-15-2) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]oxirane. InChIKey: OHLNNWAJIJAXDX-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]oxirane |
| InChIKey | OHLNNWAJIJAXDX-UHFFFAOYSA-N |
| SMILES | C1C(O1)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)