CAS 220228-07-9 appears in our catalog under these names: 2',4',5'-Trifluoropropiophenone, 97%, 2',4',5'-Trifluoropropiophenone. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g.
1-(2,4,5-trifluorophenyl)propan-1-one (CAS 220228-07-9) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 1-(2,4,5-trifluorophenyl)propan-1-one. InChIKey: YPCKLYKWNGEYFG-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 1-(2,4,5-trifluorophenyl)propan-1-one |
| InChIKey | YPCKLYKWNGEYFG-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=C(C=C1F)F)F |
Computed by PubChem (NCBI)