cas: 477859-76-0 — see every product listed under this CAS number, including other names
2-[3-CHLORO-5-(TRIFLUOROMETHYL)PYRIDINYL]-MALONIC ACID DIMETHYL ESTER, 98%, 98% (CAS 477859-76-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117Z96-250mg |
| cas | 477859-76-0 |
| size | 250mg |
| availability | 87.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 25g | 1715.60 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 50g | 2819.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate (CAS 477859-76-0) is a chemical compound with the molecular formula C11H9ClF3NO4 and a molecular weight of 311.64 g/mol. IUPAC name: dimethyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate. InChIKey: HITBMJZLAOGWTA-UHFFFAOYSA-N.
| Molecular formula | C11H9ClF3NO4 |
|---|---|
| Molecular weight | 311.64 g/mol |
| IUPAC name | dimethyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate |
| InChIKey | HITBMJZLAOGWTA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=N1)C(F)(F)F)Cl)C(=O)OC |
Computed by PubChem (NCBI)