CAS 477859-76-0 appears in our catalog under these names: 2-[3-Chloro-5-(trifluoromethyl)pyridinyl]-malonic acid dimethyl ester, 95%, 2–(3–Chloro–5–(trifluoromethyl)pyridinyl)–malonic acid dimethylester, 2-[3-CHLORO-5-(TRIFLUOROMETHYL)PYRIDINYL]-MALONIC ACID DIMETHYL ESTER, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 25g, 1g, 10g, 50g.
Dimethyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate (CAS 477859-76-0) is a chemical compound with the molecular formula C11H9ClF3NO4 and a molecular weight of 311.64 g/mol. IUPAC name: dimethyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate. InChIKey: HITBMJZLAOGWTA-UHFFFAOYSA-N.
| Molecular formula | C11H9ClF3NO4 |
|---|---|
| Molecular weight | 311.64 g/mol |
| IUPAC name | dimethyl 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanedioate |
| InChIKey | HITBMJZLAOGWTA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=N1)C(F)(F)F)Cl)C(=O)OC |
Computed by PubChem (NCBI)