2-[4-(2-Methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 96%
cas: 881314-65-4 — see every product listed under this CAS number, including other names
2-[4-(2-Methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 96% (CAS 881314-65-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A743187-1g |
| cas | 881314-65-4 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1377.19 Pln | |
| Ambeed | 10g | 2478.56 Pln | |
| Ambeed | 25g | 4052.75 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A743187 |
2-[4-(2-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 881314-65-4) is a chemical compound with the molecular formula C19H23BO3 and a molecular weight of 310.2 g/mol. IUPAC name: 2-[4-(2-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UMZWOISFJWYEGW-UHFFFAOYSA-N.
| Molecular formula | C19H23BO3 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 2-[4-(2-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UMZWOISFJWYEGW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=CC=C3OC |
Computed by PubChem (NCBI)
Synonyms:
2-[4-(2-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(4-(2-Methoxyphenyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-(2-Methoxyphenyl)phenylboronic acid, pinacol ester, 2-(2'-Methoxy-[1,1'-biphenyl]-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-{2'-methoxy-[1,1'-biphenyl]-4-yl}-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2'-Methoxybiphenyl-4-boronic acid pinacol ester, 4-(2-Methoxyphenyl)phenylboronic acid pinacol ester, 1,3,2-Dioxaborolane,2-(2'-methoxy[1,1'-biphenyl]-4-yl)-4,4,5,5-tetramethyl-, 2-(2'-Methoxy[1,1'-biphenyl]-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane