cas: 1073354-59-2 — see every product listed under this CAS number, including other names
2-[4-(N-Boc)piperazin-1-yl]phenylboronic acid pinacol ester, 98%, 98% (CAS 1073354-59-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ENH-100mg |
| cas | 1073354-59-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 520.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate (CAS 1073354-59-2) is a chemical compound with the molecular formula C21H33BN2O4 and a molecular weight of 388.3 g/mol. IUPAC name: tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate. InChIKey: NMBIQPOMVHWFBF-UHFFFAOYSA-N.
| Molecular formula | C21H33BN2O4 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate |
| InChIKey | NMBIQPOMVHWFBF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2N3CCN(CC3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)