cas: 209959-33-1 — see every product listed under this CAS number, including other names
2-[Bis(tert-Butoxycarbonyl)amino]-5-bromopyrimidine, 98% (CAS 209959-33-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213723-5G |
| cas | 209959-33-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 284.29 Pln | |
| Fluorochem | 25g | 414.46 Pln | |
| Fluorochem | 100g | 1200.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(5-bromopyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 209959-33-1) is a chemical compound with the molecular formula C14H20BrN3O4 and a molecular weight of 374.23 g/mol. IUPAC name: tert-butyl N-(5-bromopyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: GDKYABNFMXOTAN-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN3O4 |
|---|---|
| Molecular weight | 374.23 g/mol |
| IUPAC name | tert-butyl N-(5-bromopyrimidin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | GDKYABNFMXOTAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=NC=C(C=N1)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)