CAS 1650548-43-8 is the registry number for N,N-BIS(TERT-BUTOXYCARBONYL) (6-BROMOPYRAZIN-2-YL)AMINE, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl N-(6-bromopyrazin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1650548-43-8) is a chemical compound with the molecular formula C14H20BrN3O4 and a molecular weight of 374.23 g/mol. IUPAC name: tert-butyl N-(6-bromopyrazin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: GHAGHRHYUCNTJH-UHFFFAOYSA-N.
| Molecular formula | C14H20BrN3O4 |
|---|---|
| Molecular weight | 374.23 g/mol |
| IUPAC name | tert-butyl N-(6-bromopyrazin-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | GHAGHRHYUCNTJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CN=CC(=N1)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)