cas: 87331-46-2 — see every product listed under this CAS number, including other names
2-AMINO-3-NITROBENZONITRILE (CAS 87331-46-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F390194-250MG |
| cas | 87331-46-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 909.07 Pln | |
| Fluorochem | 5g | 3043.74 Pln |
| delivery time | 3-4 weeks |
|---|
2-amino-3-nitrobenzonitrile (CAS 87331-46-2) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 2-amino-3-nitrobenzonitrile. InChIKey: YWLQSBPRLUBYOR-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2-amino-3-nitrobenzonitrile |
| InChIKey | YWLQSBPRLUBYOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])N)C#N |
Computed by PubChem (NCBI)