cas: 87331-46-2 — see every product listed under this CAS number, including other names
2-Amino-3-nitrobenzonitrile, 98%, 98% (CAS 87331-46-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEHC-10g |
| cas | 87331-46-2 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2930.00 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1850.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-3-nitrobenzonitrile (CAS 87331-46-2) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 2-amino-3-nitrobenzonitrile. InChIKey: YWLQSBPRLUBYOR-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2-amino-3-nitrobenzonitrile |
| InChIKey | YWLQSBPRLUBYOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])N)C#N |
Computed by PubChem (NCBI)