cas: 6073-20-7 — see every product listed under this CAS number, including other names
2-AMINO-4-(2,4,4-TRIMETHYLPENTAN-2-YL)PHENOL, 97% (CAS 6073-20-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F844122-100MG |
| cas | 6073-20-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 851.80 Pln | |
| Fluorochem | 1g | 1788.97 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-4-(2,4,4-trimethylpentan-2-yl)phenol (CAS 6073-20-7) is a chemical compound with the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. IUPAC name: 2-amino-4-(2,4,4-trimethylpentan-2-yl)phenol. InChIKey: BESJCRMQEYZHPM-UHFFFAOYSA-N.
| Molecular formula | C14H23NO |
|---|---|
| Molecular weight | 221.34 g/mol |
| IUPAC name | 2-amino-4-(2,4,4-trimethylpentan-2-yl)phenol |
| InChIKey | BESJCRMQEYZHPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=CC(=C(C=C1)O)N |
Computed by PubChem (NCBI)