cas: 6073-20-7 — see every product listed under this CAS number, including other names
2-amino-4-(2,4,4-trimethylpentan-2-yl)phenol, 97%, 97% (CAS 6073-20-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJEW-100mg |
| cas | 6073-20-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 1g | 1096.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-4-(2,4,4-trimethylpentan-2-yl)phenol (CAS 6073-20-7) is a chemical compound with the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. IUPAC name: 2-amino-4-(2,4,4-trimethylpentan-2-yl)phenol. InChIKey: BESJCRMQEYZHPM-UHFFFAOYSA-N.
| Molecular formula | C14H23NO |
|---|---|
| Molecular weight | 221.34 g/mol |
| IUPAC name | 2-amino-4-(2,4,4-trimethylpentan-2-yl)phenol |
| InChIKey | BESJCRMQEYZHPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=CC(=C(C=C1)O)N |
Computed by PubChem (NCBI)