cas: 402-13-1 — see every product listed under this CAS number, including other names
2-AMINO-4-(TRIFLUOROMETHYL)BENZOIC ACID, 98%, 98% (CAS 402-13-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GE0-1g |
| cas | 402-13-1 |
| size | 1g |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 942.80 Pln | |
| Chemat | 500g | 4521.60 Pln | |
| Chemat | 1kg | 7206.80 Pln | |
| Chemat | 5kg | 23356.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-4-(trifluoromethyl)benzoic acid (CAS 402-13-1) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 2-amino-4-(trifluoromethyl)benzoic acid. InChIKey: NQTLZJODEOHALT-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 2-amino-4-(trifluoromethyl)benzoic acid |
| InChIKey | NQTLZJODEOHALT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)C(=O)O |
Computed by PubChem (NCBI)