cas: 402-13-1 — see every product listed under this CAS number, including other names
2-Amino-4-trifluoromethylbenzoic acid, 97% (CAS 402-13-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013879-1G |
| cas | 402-13-1 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 25g | 310.33 Pln | |
| Fluorochem | 50g | 555.03 Pln | |
| Fluorochem | 100g | 1049.65 Pln | |
| Fluorochem | 500g | 4902.46 Pln | |
| Fluorochem | 1kg | 7672.32 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2-amino-4-(trifluoromethyl)benzoic acid (CAS 402-13-1) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 2-amino-4-(trifluoromethyl)benzoic acid. InChIKey: NQTLZJODEOHALT-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 2-amino-4-(trifluoromethyl)benzoic acid |
| InChIKey | NQTLZJODEOHALT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)C(=O)O |
Computed by PubChem (NCBI)