cas: 28448-11-5 — see every product listed under this CAS number, including other names
2-AMINO-4-METHYL-QUINOLINE-3-CARBONITRILE, 98%, 98% (CAS 28448-11-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BDMR-5g |
| cas | 28448-11-5 |
| size | 5g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 5181.20 Pln | |
| Chemat | 250mg | 515.60 Pln | |
| Chemat | 1g | 1427.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-4-methylquinoline-3-carbonitrile (CAS 28448-11-5) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. IUPAC name: 2-amino-4-methylquinoline-3-carbonitrile. InChIKey: DXXUIIMDJKUSES-UHFFFAOYSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 2-amino-4-methylquinoline-3-carbonitrile |
| InChIKey | DXXUIIMDJKUSES-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=CC=CC=C12)N)C#N |
Computed by PubChem (NCBI)