cas: 142404-84-0 — see every product listed under this CAS number, including other names
2-Acetamido-5-bromo-6-methylpyridine, >98.0%(HPLC)(T) (CAS 142404-84-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A3032-1G |
| cas | 142404-84-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 275.70 Pln | |
| TCI | 5g | 801.84 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
N-(5-bromo-6-methyl-2-pyridinyl)acetamide (CAS 142404-84-0) is a chemical compound with the molecular formula C8H9BrN2O and a molecular weight of 229.07 g/mol. IUPAC name: N-(5-bromo-6-methyl-2-pyridinyl)acetamide. InChIKey: LDBWQGWJCPCZIN-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | N-(5-bromo-6-methyl-2-pyridinyl)acetamide |
| InChIKey | LDBWQGWJCPCZIN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)NC(=O)C)Br |
Computed by PubChem (NCBI)