CAS 2167395-98-2 appears in our catalog under these names: 5-Bromo-2-cyclobutylpyridazin-3(2H)-one, 98%, 5-Bromo-2-cyclobutyl-2,3-dihydropyridazin-3-one, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-bromo-2-cyclobutylpyridazin-3-one (CAS 2167395-98-2) is a chemical compound with the molecular formula C8H9BrN2O and a molecular weight of 229.07 g/mol. IUPAC name: 5-bromo-2-cyclobutylpyridazin-3-one. InChIKey: QIWYQFQPFYNPJS-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 5-bromo-2-cyclobutylpyridazin-3-one |
| InChIKey | QIWYQFQPFYNPJS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)N2C(=O)C=C(C=N2)Br |
Computed by PubChem (NCBI)