cas: 711-79-5 — see every product listed under this CAS number, including other names
2-Acetyl-1-naphthol, 98.19% (CAS 711-79-5) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W095147-10 g |
| cas | 711-79-5 |
| size | 10 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 505.45 Pln | |
| MedChemExpress | 25 g | 876.97 Pln | |
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 1 g | 240.74 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 98.19% |
1-(1-hydroxynaphthalen-2-yl)ethanone (CAS 711-79-5) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 1-(1-hydroxynaphthalen-2-yl)ethanone. InChIKey: JBGJVMVWYWUVOW-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 1-(1-hydroxynaphthalen-2-yl)ethanone |
| InChIKey | JBGJVMVWYWUVOW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C2=CC=CC=C2C=C1)O |
Computed by PubChem (NCBI)