cas: 1105679-25-1 — see every product listed under this CAS number, including other names
2-Amino-2-(3,4-dichlorophenyl)acetic Acid Hydrochloride, 95%, 95% (CAS 1105679-25-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1109JE-250mg |
| cas | 1105679-25-1 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1302.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-2-(3,4-dichlorophenyl)acetic acid;hydrochloride (CAS 1105679-25-1) is a chemical compound with the molecular formula C8H8Cl3NO2 and a molecular weight of 256.5 g/mol. IUPAC name: 2-amino-2-(3,4-dichlorophenyl)acetic acid;hydrochloride. InChIKey: VMYHAWIOLGVDRJ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO2 |
|---|---|
| Molecular weight | 256.5 g/mol |
| IUPAC name | 2-amino-2-(3,4-dichlorophenyl)acetic acid;hydrochloride |
| InChIKey | VMYHAWIOLGVDRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)