Products 1137014-87-9

CAS 1137014-87-9 appears in our catalog under these names: 2-Amino-(3,5-dichloro-phenyl)-acetic acid hydrochloride, 95%, 2–Amino–2–(3,5–dichlorophenyl)acetic acid hydrochloride, H-DL-Phg(3,5-DiCl)-OH HCl 95%, 2-Amino-2-(3,5-dichlorophenyl)acetic acid hydrochloride, 95%, 95%, 2-Amino-2-(3,5-dichlorophenyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-amino-2-(3,5-dichlorophenyl)acetic acid;hydrochloride (CAS 1137014-87-9) is a chemical compound with the molecular formula C8H8Cl3NO2 and a molecular weight of 256.5 g/mol. IUPAC name: 2-amino-2-(3,5-dichlorophenyl)acetic acid;hydrochloride. InChIKey: CPQMVIKDRJMUKS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl3NO2
Molecular weight256.5 g/mol
IUPAC name2-amino-2-(3,5-dichlorophenyl)acetic acid;hydrochloride
InChIKeyCPQMVIKDRJMUKS-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Cl)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)