cas: 609-86-9 — see every product listed under this CAS number, including other names
2-Amino-3,5-diiodobenzoic acid, 97%(LC-MS),RG, 97%(LC-MS),RG (CAS 609-86-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GD7-250mg |
| cas | 609-86-9 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 100g | 3347.60 Pln |
| purity | 97%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2-amino-3,5-diiodobenzoic acid (CAS 609-86-9) is a chemical compound with the molecular formula C7H5I2NO2 and a molecular weight of 388.93 g/mol. IUPAC name: 2-amino-3,5-diiodobenzoic acid. InChIKey: RFIBDMCPIREZKC-UHFFFAOYSA-N.
| Molecular formula | C7H5I2NO2 |
|---|---|
| Molecular weight | 388.93 g/mol |
| IUPAC name | 2-amino-3,5-diiodobenzoic acid |
| InChIKey | RFIBDMCPIREZKC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)I)I |
Computed by PubChem (NCBI)