CAS 2122-61-4 appears in our catalog under these names: 4-Amino-3,5-diiodobenzoic acid, 4-Amino-3,5-diiodobenzoic acid, 95%, 4-Amino-3,5-diiodobenzoic acid, 97%, 97%, 4-Amino-3,5-diiodobenzoic acid, 90% tech. grade. Offered by: Biosynth, AmBeed, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 1g.
4-amino-3,5-diiodobenzoic acid (CAS 2122-61-4) is a chemical compound with the molecular formula C7H5I2NO2 and a molecular weight of 388.93 g/mol. IUPAC name: 4-amino-3,5-diiodobenzoic acid. InChIKey: WXTVPMWCUMEVSZ-UHFFFAOYSA-N.
| Molecular formula | C7H5I2NO2 |
|---|---|
| Molecular weight | 388.93 g/mol |
| IUPAC name | 4-amino-3,5-diiodobenzoic acid |
| InChIKey | WXTVPMWCUMEVSZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)N)I)C(=O)O |
Computed by PubChem (NCBI)