CAS 50472-10-1 appears in our catalog under these names: 2-Amino-3,6-dimethoxybenzoic acid, 95%, 95%, 2-Amino-3,6-dimethoxybenzoic acid, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-amino-3,6-dimethoxybenzoic acid (CAS 50472-10-1) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-amino-3,6-dimethoxybenzoic acid. InChIKey: RRQMXQWSIJERLR-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-amino-3,6-dimethoxybenzoic acid |
| InChIKey | RRQMXQWSIJERLR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OC)N)C(=O)O |
Computed by PubChem (NCBI)