CAS 5653-40-7 appears in our catalog under these names: 2-Amino-4,5-dimethoxybenzoic acid, 98%, 2-Amino-4,5-dimethoxybenzoic Acid, 4,5–Dimethoxyanthranilic Acid, 2-Amino-4,5-dimethoxybenzoic acid/ 99%, 2-Amino-4,5-dimethoxybenzoic acid, 98% . Offered by: Combi-blocks, TRC, GLPBio, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 25g, 5g, 500g, 10g, 1kg, 0,5kg, 2kg.
2-amino-4,5-dimethoxybenzoic acid (CAS 5653-40-7) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-amino-4,5-dimethoxybenzoic acid. InChIKey: HJVAVGOPTDJYOJ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-amino-4,5-dimethoxybenzoic acid |
| InChIKey | HJVAVGOPTDJYOJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)N)OC |
Computed by PubChem (NCBI)