cas: 1215361-76-4 — see every product listed under this CAS number, including other names
2-Amino-3-(3-fluoro-4-(trifluoromethyl)phenyl)propanoic acid hydrochloride, 97% (CAS 1215361-76-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 25g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A2329677-250mg |
| cas | 1215361-76-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 493.15 Pln | |
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 1g | 586.27 Pln | |
| Fluorochem | 5g | 2137.81 Pln | |
| Fluorochem | 10g | 3585.21 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1254.80 Pln | |
| Chemat | 10g | 2214.80 Pln | |
| Chemat | 25g | 3909.20 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-3-[3-fluoro-4-(trifluoromethyl)phenyl]propanoic acid;hydrochloride (CAS 1215361-76-4) is a chemical compound with the molecular formula C10H10ClF4NO2 and a molecular weight of 287.64 g/mol. IUPAC name: 2-amino-3-[3-fluoro-4-(trifluoromethyl)phenyl]propanoic acid;hydrochloride. InChIKey: JXYKJGZNRQQOQD-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF4NO2 |
|---|---|
| Molecular weight | 287.64 g/mol |
| IUPAC name | 2-amino-3-[3-fluoro-4-(trifluoromethyl)phenyl]propanoic acid;hydrochloride |
| InChIKey | JXYKJGZNRQQOQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)N)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)