CAS 2375259-91-7 is the registry number for 2-Amino-3-[2-fluoro-3-(trifluoromethyl)phenyl]propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-amino-3-[2-fluoro-3-(trifluoromethyl)phenyl]propanoic acid;hydrochloride (CAS 2375259-91-7) is a chemical compound with the molecular formula C10H10ClF4NO2 and a molecular weight of 287.64 g/mol. IUPAC name: 2-amino-3-[2-fluoro-3-(trifluoromethyl)phenyl]propanoic acid;hydrochloride. InChIKey: RYMZEPBAPMIEPZ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF4NO2 |
|---|---|
| Molecular weight | 287.64 g/mol |
| IUPAC name | 2-amino-3-[2-fluoro-3-(trifluoromethyl)phenyl]propanoic acid;hydrochloride |
| InChIKey | RYMZEPBAPMIEPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)