cas: 1956-25-8 — see every product listed under this CAS number, including other names
2-Amino-3-(5-(benzyloxy)-1H-indol-3-yl)propanoic acid, 98% (CAS 1956-25-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720637-250MG |
| cas | 1956-25-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 2424.16 Pln | |
| Fluorochem | 500mg | 3600.83 Pln | |
| Fluorochem | 1g | 5355.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-3-(5-phenylmethoxy-1H-indol-3-yl)propanoic acid (CAS 1956-25-8) is a chemical compound with the molecular formula C18H18N2O3 and a molecular weight of 310.3 g/mol. IUPAC name: 2-amino-3-(5-phenylmethoxy-1H-indol-3-yl)propanoic acid. InChIKey: DFGNDJBYANKHIO-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O3 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 2-amino-3-(5-phenylmethoxy-1H-indol-3-yl)propanoic acid |
| InChIKey | DFGNDJBYANKHIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3CC(C(=O)O)N |
Computed by PubChem (NCBI)