CAS 390811-95-7 appears in our catalog under these names: 1-Cyclohexyl-2-(3-furanyl)-1h-benzimidazole-5-carboxylic acid, 95%, 95%, 1-Cyclohexyl-2-(3-furanyl)-1h-benzimidazole-5-carboxylic acid, 95%, 1-Cyclohexyl-2-(furan-3-yl)-1H-benzo(d)imidazole-5-carboxylic acid, 98%, 1-CYCLOHEXYL-2-(FURAN-3-YL)-1H-BENZO[D]IMIDAZOLE-5-CARBOXYLIC ACID, 99%. Offered by: Chemat, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-cyclohexyl-2-(furan-3-yl)benzimidazole-5-carboxylic acid (CAS 390811-95-7) is a chemical compound with the molecular formula C18H18N2O3 and a molecular weight of 310.3 g/mol. IUPAC name: 1-cyclohexyl-2-(furan-3-yl)benzimidazole-5-carboxylic acid. InChIKey: JTLQUCGDQKGJMM-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O3 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 1-cyclohexyl-2-(furan-3-yl)benzimidazole-5-carboxylic acid |
| InChIKey | JTLQUCGDQKGJMM-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C3=C(C=C(C=C3)C(=O)O)N=C2C4=COC=C4 |
Computed by PubChem (NCBI)