2-Amino-3-bromo-N-phenylbenzamide, 95%
cas: 1369151-58-5 — see every product listed under this CAS number, including other names
2-Amino-3-bromo-N-phenylbenzamide, 95% (CAS 1369151-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1598338-100mg |
| cas | 1369151-58-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1705.38 Pln | |
| BLDpharm | 100mg | 336.57 Pln | |
| BLDpharm | 250mg | 630.91 Pln | |
| BLDpharm | 1g | 1674.99 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 453.20 Pln | |
| Chemat | 1g | 1235.60 Pln | |
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 2294.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-3-bromo-N-phenylbenzamide (CAS 1369151-58-5) is a chemical compound with the molecular formula C13H11BrN2O and a molecular weight of 291.14 g/mol. IUPAC name: 2-amino-3-bromo-N-phenylbenzamide. InChIKey: BYPMHMCHEHLRFU-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 2-amino-3-bromo-N-phenylbenzamide |
| InChIKey | BYPMHMCHEHLRFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=C(C(=CC=C2)Br)N |
Computed by PubChem (NCBI)