CAS 436090-25-4 is the registry number for N-(4-Amino-2-bromophenyl)benzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-(4-amino-2-bromophenyl)benzamide (CAS 436090-25-4) is a chemical compound with the molecular formula C13H11BrN2O and a molecular weight of 291.14 g/mol. IUPAC name: N-(4-amino-2-bromophenyl)benzamide. InChIKey: BHHSEFHSAALKIY-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | N-(4-amino-2-bromophenyl)benzamide |
| InChIKey | BHHSEFHSAALKIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)N)Br |
Computed by PubChem (NCBI)