cas: 1246372-66-6 — see every product listed under this CAS number, including other names
2-Amino-3-cyanopyridine-5-boronic Acid Pinacol Ester, 97%, 97% (CAS 1246372-66-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111MHP-100mg |
| cas | 1246372-66-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 227.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile (CAS 1246372-66-6) is a chemical compound with the molecular formula C12H16BN3O2 and a molecular weight of 245.09 g/mol. IUPAC name: 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile. InChIKey: KRNXYPYYVHFVQS-UHFFFAOYSA-N.
| Molecular formula | C12H16BN3O2 |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
| InChIKey | KRNXYPYYVHFVQS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)N)C#N |
Computed by PubChem (NCBI)