CAS 1257651-13-0 appears in our catalog under these names: 1H-Benzo[d][1,2,3]triazol-5-ylboronic acid pinacol ester, 96%, 1H-Benzo(d)(1,2,3)triazol-5-ylboronic acid pinacol ester, 1H-Benzo[d][1,2,3]triazol-5-ylboronic acid, pinacol ester 96%, 1H-BENZO[D][1,2,3]TRIAZOL-5-YLBORONIC A&, 1H-Benzo[d][1,2,3]triazole-6-boronic Acid Pinacol Ester, >97%, >97%. Offered by: Combi-blocks, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 5g, 0,5g, 100mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole (CAS 1257651-13-0) is a chemical compound with the molecular formula C12H16BN3O2 and a molecular weight of 245.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole. InChIKey: QUYDCPHDUNQFKF-UHFFFAOYSA-N.
| Molecular formula | C12H16BN3O2 |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzotriazole |
| InChIKey | QUYDCPHDUNQFKF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NNN=C3C=C2 |
Computed by PubChem (NCBI)