cas: 18344-51-9 — see every product listed under this CAS number, including other names
2-Amino-3-methyl-5-nitropyridine, 95% (CAS 18344-51-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035845-10G |
| cas | 18344-51-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 143.72 Pln | |
| Fluorochem | 100g | 346.77 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-methyl-5-nitropyridin-2-amine (CAS 18344-51-9) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-5-nitropyridin-2-amine. InChIKey: JLPYUDJJBGYXEZ-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-5-nitropyridin-2-amine |
| InChIKey | JLPYUDJJBGYXEZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1N)[N+](=O)[O-] |
Computed by PubChem (NCBI)