CAS 3034-19-3 appears in our catalog under these names: 2-Nitrophenylhydrazine, 98%, (2-Nitrophenyl)hydrazine (Contains ~30-40% water as stabilizer), >95% (HPLC), 2-Nitrophenylhydrazine, 2-Nitrophenylhydrazine, 97%, moistened with ca 30% water, 2-NITROPHENYLHYDRAZINE, 97%. Offered by: Combi-blocks, TRC, Biosynth, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 25g, 100g, 5g, 1g, 2,5g, 250mg, 50g, 10g.
(2-nitrophenyl)hydrazine (CAS 3034-19-3) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: (2-nitrophenyl)hydrazine. InChIKey: FRBUNLLUASHNDJ-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | (2-nitrophenyl)hydrazine |
| InChIKey | FRBUNLLUASHNDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)