cas: 40106-15-8 — see every product listed under this CAS number, including other names
2-Amino-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide 95+% (CAS 40106-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A123907-100mg |
| cas | 40106-15-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 403.75 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1115.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A123907 |
2-amino-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (CAS 40106-15-8) is a chemical compound with the molecular formula C11H16N2OS and a molecular weight of 224.32 g/mol. IUPAC name: 2-amino-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide. InChIKey: XZCZLVCNYYVFKH-UHFFFAOYSA-N.
| Molecular formula | C11H16N2OS |
|---|---|
| Molecular weight | 224.32 g/mol |
| IUPAC name | 2-amino-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| InChIKey | XZCZLVCNYYVFKH-UHFFFAOYSA-N |
| SMILES | C1CCCC2=C(CC1)C(=C(S2)N)C(=O)N |
Computed by PubChem (NCBI)