cas: 40106-15-8 — see every product listed under this CAS number, including other names
2-Amino-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide, 95+%, 95+% (CAS 40106-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYLR-100mg |
| cas | 40106-15-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1154.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-amino-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (CAS 40106-15-8) is a chemical compound with the molecular formula C11H16N2OS and a molecular weight of 224.32 g/mol. IUPAC name: 2-amino-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide. InChIKey: XZCZLVCNYYVFKH-UHFFFAOYSA-N.
| Molecular formula | C11H16N2OS |
|---|---|
| Molecular weight | 224.32 g/mol |
| IUPAC name | 2-amino-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| InChIKey | XZCZLVCNYYVFKH-UHFFFAOYSA-N |
| SMILES | C1CCCC2=C(CC1)C(=C(S2)N)C(=O)N |
Computed by PubChem (NCBI)