CAS 21577-57-1 appears in our catalog under these names: 2–amino–4,6–dimethoxybenzoic acid, 2-Amino-4,6-dimethoxybenzoic acid, 2-Amino-4,6-dimethoxybenzoic acid, 98%, 98%, 2-Amino-4,6-dimethoxybenzoic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 2g, 100mg, 250mg, 10g.
2-amino-4,6-dimethoxybenzoic acid (CAS 21577-57-1) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-amino-4,6-dimethoxybenzoic acid. InChIKey: HZBQKANLOSWJLU-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-amino-4,6-dimethoxybenzoic acid |
| InChIKey | HZBQKANLOSWJLU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)O)N |
Computed by PubChem (NCBI)