cas: 66521-65-1 — see every product listed under this CAS number, including other names
2-Amino-4-(2-pyridinyl)-pyrimidine (CAS 66521-65-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048154-1G |
| cas | 66521-65-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1664.02 Pln | |
| Fluorochem | 500mg | 1127.75 Pln |
| delivery time | 2-3 weeks |
|---|
4-pyridin-2-ylpyrimidin-2-amine (CAS 66521-65-1) is a chemical compound with the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. IUPAC name: 4-pyridin-2-ylpyrimidin-2-amine. InChIKey: RHXVSZXHWDQESH-UHFFFAOYSA-N.
| Molecular formula | C9H8N4 |
|---|---|
| Molecular weight | 172.19 g/mol |
| IUPAC name | 4-pyridin-2-ylpyrimidin-2-amine |
| InChIKey | RHXVSZXHWDQESH-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=NC=C2)N |
Computed by PubChem (NCBI)