CAS 1119505-52-0 appears in our catalog under these names: 1-Ethyl-1,2,3-benzotriazole-5-carbonitrile, 98%, 1-Ethyl-1,2,3-benzotriazole-5-carbonitrile, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g, 100g, 250g.
1-ethylbenzotriazole-5-carbonitrile (CAS 1119505-52-0) is a chemical compound with the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. IUPAC name: 1-ethylbenzotriazole-5-carbonitrile. InChIKey: QXYWGWKUYHTRJX-UHFFFAOYSA-N.
| Molecular formula | C9H8N4 |
|---|---|
| Molecular weight | 172.19 g/mol |
| IUPAC name | 1-ethylbenzotriazole-5-carbonitrile |
| InChIKey | QXYWGWKUYHTRJX-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C#N)N=N1 |
Computed by PubChem (NCBI)