cas: 445-14-7 — see every product listed under this CAS number, including other names
2-Amino-4-chlorobenzotrifluoride 98% (CAS 445-14-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A273417-1g |
| cas | 445-14-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 932.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A273417 |
5-chloro-2-(trifluoromethyl)aniline (CAS 445-14-7) is a chemical compound with the molecular formula C7H5ClF3N and a molecular weight of 195.57 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)aniline. InChIKey: GXMFVMMXHKXSBI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N |
|---|---|
| Molecular weight | 195.57 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)aniline |
| InChIKey | GXMFVMMXHKXSBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)C(F)(F)F |
Computed by PubChem (NCBI)