cas: 93-67-4 — see every product listed under this CAS number, including other names
2-Amino-4-chlorodiphenyl Ether, >98.0%(GC) (CAS 93-67-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2222-25G |
| cas | 93-67-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 162.60 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
5-chloro-2-phenoxyaniline (CAS 93-67-4) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 5-chloro-2-phenoxyaniline. InChIKey: SXEBHIMOUHBBOS-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 5-chloro-2-phenoxyaniline |
| InChIKey | SXEBHIMOUHBBOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)